ChemNet > CAS > 68585-05-7 Octadecanoic acid, reaction products with diethylenetriamine, di-Et sulfate-quaternized
68585-05-7 Octadecanoic acid, reaction products with diethylenetriamine, di-Et sulfate-quaternized
Название продукта |
Octadecanoic acid, reaction products with diethylenetriamine, di-Et sulfate-quaternized |
Синонимы |
Quaternized stearic imidazoline amide; Reaction products of stearic acid with diethylenetriamine, diethyl sulfate quaternized; N-(2-aminoethyl)ethane-1,2-diamine; diethyl sulfate; stearic acid |
Молекулярная формула |
C26H59N3O6S |
Молекулярный вес |
541.8282 |
InChI |
InChI=1/C18H36O2.C4H13N3.C4H10O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-3-7-9(5,6)8-4-2/h2-17H2,1H3,(H,19,20);7H,1-6H2;3-4H2,1-2H3 |
Регистрационный номер CAS |
68585-05-7 |
EINECS |
271-548-8 |
Молекулярная структура |
|
Точка кипения |
359.4°C at 760 mmHg |
Температура вспышки |
162.4°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
|
|