ChemNet > CAS > 71642-16-5 3-Methyl-2,4,6-tribromoaniline
71642-16-5 3-Methyl-2,4,6-tribromoaniline
| Название продукта |
3-Methyl-2,4,6-tribromoaniline |
| Синонимы |
2,4,6-Tribromo-3-methylaniline~2,4,6-Tribromo-m-toluidine; 2,4,6-Tribromo-m-toluidine; 2,4,6-tribromo-3-methylaniline |
| Молекулярная формула |
C7H6Br3N |
| Молекулярный вес |
343.8412 |
| InChI |
InChI=1/C7H6Br3N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3 |
| Регистрационный номер CAS |
71642-16-5 |
| Молекулярная структура |
|
| Плотность |
2.196g/cm3 |
| Температура плавления |
101-102℃ |
| Точка кипения |
314.1°C at 760 mmHg |
| Показатель преломления |
1.668 |
| Температура вспышки |
143.8°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
