ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
Название продукта |
Bromodichloromethane |
Синонимы |
FC-20B1 |
Молекулярная формула |
CHBrCl2 |
Молекулярный вес |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
Регистрационный номер CAS |
75-27-4 |
EINECS |
200-856-7 |
Молекулярная структура |
|
Плотность |
2.013g/cm3 |
Температура плавления |
-55℃ |
Точка кипения |
89.7°C at 760 mmHg |
Показатель преломления |
1.503 |
Температура вспышки |
1.3°C |
Символы опасности |
Xn:Harmful;
|
Риск коды |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Характеристики безопасности |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|