ChemNet > CAS > 769-40-4 2,3,5,6-tetrafluorothiophenol
769-40-4 2,3,5,6-tetrafluorothiophenol
| Название продукта |
2,3,5,6-tetrafluorothiophenol |
| Синонимы |
2,3,5,6-Tetrafluorobenzenethiol; 2,3,5,6-tetrafluorobenzenethiolate |
| Молекулярная формула |
C6HF4S |
| Молекулярный вес |
181.1313 |
| InChI |
InChI=1/C6H2F4S/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H/p-1 |
| Регистрационный номер CAS |
769-40-4 |
| EINECS |
212-210-1 |
| Молекулярная структура |
|
| Точка кипения |
152.6°C at 760 mmHg |
| Температура вспышки |
48.3°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
