ChemNet > CAS > 78881-21-7 4-Amino-3-methylbenzonitrile
78881-21-7 4-Amino-3-methylbenzonitrile
Название продукта |
4-Amino-3-methylbenzonitrile |
Синонимы |
4-Amino-m-tolunitrile; 4-Cyano-o-toluidine; 3-Methyl-4-aminobenzonitrile |
Молекулярная формула |
C8H8N2 |
Молекулярный вес |
132.1625 |
InChI |
InChI=1/C8H8N2/c1-6-4-7(5-9)2-3-8(6)10/h2-4H,10H2,1H3 |
Регистрационный номер CAS |
78881-21-7 |
Молекулярная структура |
|
Плотность |
1.1g/cm3 |
Точка кипения |
304.5°C at 760 mmHg |
Показатель преломления |
1.575 |
Температура вспышки |
138°C |
Символы опасности |
|
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|