ChemNet > CAS > 83463-62-1 Bromochloroacetonitrile
83463-62-1 Bromochloroacetonitrile
| Название продукта |
Bromochloroacetonitrile |
| Синонимы |
Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
| Молекулярная формула |
C2HBrClN |
| Молекулярный вес |
154.393 |
| InChI |
InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
| Регистрационный номер CAS |
83463-62-1 |
| Молекулярная структура |
|
| Плотность |
1.932g/cm3 |
| Точка кипения |
121.1°C at 760 mmHg |
| Показатель преломления |
1.506 |
| Температура вспышки |
27.1°C |
| Символы опасности |
|
| Риск коды |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
