ChemNet > CAS > 89581-82-8 2-Acetyl-3-chlorothiophene
89581-82-8 2-Acetyl-3-chlorothiophene
| Название продукта |
2-Acetyl-3-chlorothiophene |
| Синонимы |
1-(3-chlorothiophen-2-yl)ethanone |
| Молекулярная формула |
C6H5ClOS |
| Молекулярный вес |
160.6213 |
| InChI |
InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| Регистрационный номер CAS |
89581-82-8 |
| Молекулярная структура |
|
| Плотность |
1.312g/cm3 |
| Точка кипения |
219.9°C at 760 mmHg |
| Показатель преломления |
1.559 |
| Температура вспышки |
86.8°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
