ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
Название продукта |
poly(chlorotrifluoroethylene) |
Синонимы |
halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
Молекулярная формула |
C2ClF3 |
Молекулярный вес |
116.4693 |
InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
Регистрационный номер CAS |
9002-83-9 |
Молекулярная структура |
|
Плотность |
1.9 |
Температура плавления |
210℃ |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|