ChemNet > CAS > 108847-76-3 Thianthrene-1-boronic acid
108847-76-3 Thianthrene-1-boronic acid
اسم المنتج |
Thianthrene-1-boronic acid |
الاسم المستعار |
1-Thianthrenylboronic acid; thianthren-1-ylboronic acid |
الصيغة الجزيئية |
C12H9BO2S2 |
الوزن الجزيئي الغرامي |
260.1397 |
InChI |
InChI=1/C12H9BO2S2/c14-13(15)8-4-3-7-11-12(8)17-10-6-2-1-5-9(10)16-11/h1-7,14-15H |
إستراتيجية المساعدة القطرية |
108847-76-3 |
بنية جزيئية |
|
كثافة |
1.48g/cm3 |
درجة الإنصهار |
146-149℃ |
نقطة الغليان |
472.7°C at 760 mmHg |
معامل الإنكسار |
1.756 |
نقطة الوميض |
239.7°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|