ChemNet > CAS > 110-49-6 2-Methoxyethyl acetate
110-49-6 2-Methoxyethyl acetate
| اسم المنتج |
2-Methoxyethyl acetate |
| الاسم المستعار |
Methyl Cellosolve?acetate; 1-Acetoxy-2-methoxyethane; Ethylene glycol monomethyl ether acetate; Methyl Cellosolve(rg acetate; 2-sulfanylethyl acetate |
| الصيغة الجزيئية |
C4H8O2S |
| الوزن الجزيئي الغرامي |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| إستراتيجية المساعدة القطرية |
110-49-6 |
| المفوضية الأوروبية رقم |
203-772-9 |
| بنية جزيئية |
|
| كثافة |
1.072g/cm3 |
| درجة الإنصهار |
-65℃ |
| نقطة الغليان |
162.7°C at 760 mmHg |
| معامل الإنكسار |
1.452 |
| نقطة الوميض |
57.6°C |
| علامات على البضائع الخطرة |
 T:Toxic;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R60:May impair fertility.;
R61:May cause harm to the unborn child.;
|
| شروط الأمن |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
