ChemNet > CAS > 1124-08-9 1,4-Diiodo-2,5-dimethylbenzene
1124-08-9 1,4-Diiodo-2,5-dimethylbenzene
| اسم المنتج |
1,4-Diiodo-2,5-dimethylbenzene |
| الاسم المستعار |
2,5-Diiodo-p-xylene
|
| الصيغة الجزيئية |
C8H8I2 |
| الوزن الجزيئي الغرامي |
357.9581 |
| InChI |
InChI=1/C8H8I2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2H3 |
| إستراتيجية المساعدة القطرية |
1124-08-9 |
| بنية جزيئية |
|
| كثافة |
2.154g/cm3 |
| درجة الإنصهار |
103℃ |
| نقطة الغليان |
306.2°C at 760 mmHg |
| معامل الإنكسار |
1.665 |
| نقطة الوميض |
147.6°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
