ChemNet > CAS > 116632-39-4 Bromoiodotoluene
116632-39-4 Bromoiodotoluene
| اسم المنتج |
Bromoiodotoluene |
| الاسم المستعار |
5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
| الصيغة الجزيئية |
C7H6BrI |
| الوزن الجزيئي الغرامي |
296.931 |
| InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| إستراتيجية المساعدة القطرية |
116632-39-4 |
| بنية جزيئية |
|
| كثافة |
2.062g/cm3 |
| نقطة الغليان |
264.2°C at 760 mmHg |
| معامل الإنكسار |
1.636 |
| نقطة الوميض |
113.6°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
