ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
| اسم المنتج |
4-(Dimethylamino)benzonitrile |
| الاسم المستعار |
4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
| الصيغة الجزيئية |
C9H10N2 |
| الوزن الجزيئي الغرامي |
146.1891 |
| InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| إستراتيجية المساعدة القطرية |
1197-19-9 |
| المفوضية الأوروبية رقم |
214-819-8 |
| بنية جزيئية |
|
| كثافة |
1.04g/cm3 |
| درجة الإنصهار |
70-76℃ |
| نقطة الغليان |
318.8°C at 760 mmHg |
| معامل الإنكسار |
1.55 |
| نقطة الوميض |
145.4°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|
