ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
اسم المنتج |
4-(Dimethylamino)benzonitrile |
الاسم المستعار |
4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
الصيغة الجزيئية |
C9H10N2 |
الوزن الجزيئي الغرامي |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
إستراتيجية المساعدة القطرية |
1197-19-9 |
المفوضية الأوروبية رقم |
214-819-8 |
بنية جزيئية |
|
كثافة |
1.04g/cm3 |
درجة الإنصهار |
70-76℃ |
نقطة الغليان |
318.8°C at 760 mmHg |
معامل الإنكسار |
1.55 |
نقطة الوميض |
145.4°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|