ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
| اسم المنتج |
Difluoromandelicacid |
| الاسم المستعار |
3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
| الصيغة الجزيئية |
C8H6F2O3 |
| الوزن الجزيئي الغرامي |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| إستراتيجية المساعدة القطرية |
132741-29-8 |
| بنية جزيئية |
|
| كثافة |
1.522g/cm3 |
| درجة الإنصهار |
92-94℃ |
| نقطة الغليان |
320.7°C at 760 mmHg |
| معامل الإنكسار |
1.542 |
| نقطة الوميض |
147.8°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
