ChemNet > CAS > 133082-13-0 (S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol
133082-13-0 (S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol
اسم المنتج |
(S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol |
الاسم المستعار |
(1S)-1-(2-Chlorophenyl)ethane-1,2-diol |
الصيغة الجزيئية |
C8H9ClO2 |
الوزن الجزيئي الغرامي |
172.6089 |
InChI |
InChI=1/C8H9ClO2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8,10-11H,5H2/t8-/m1/s1 |
إستراتيجية المساعدة القطرية |
133082-13-0 |
بنية جزيئية |
|
كثافة |
1.328g/cm3 |
درجة الإنصهار |
68-75℃ |
نقطة الغليان |
322°C at 760 mmHg |
معامل الإنكسار |
1.588 |
نقطة الوميض |
148.5°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|