ChemNet > CAS > 135-01-3 1,2-diethylbenzene
135-01-3 1,2-diethylbenzene
| اسم المنتج |
1,2-diethylbenzene |
| الاسم المستعار |
Diethylbenzene; o-Diethylbenzene |
| الصيغة الجزيئية |
C10H14 |
| الوزن الجزيئي الغرامي |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
| إستراتيجية المساعدة القطرية |
135-01-3 |
| المفوضية الأوروبية رقم |
205-170-1 |
| بنية جزيئية |
|
| كثافة |
0.865g/cm3 |
| نقطة الغليان |
183.5°C at 760 mmHg |
| معامل الإنكسار |
1.496 |
| نقطة الوميض |
49.4°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
