ChemNet > CAS > 135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
| اسم المنتج |
2,4,6-Trimethoxybenzeneboronic acid |
| الاسم المستعار |
2,4,6-Trimethoxyphenylboronic acid |
| الصيغة الجزيئية |
C9H13BO5 |
| الوزن الجزيئي الغرامي |
212.0075 |
| InChI |
InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
| إستراتيجية المساعدة القطرية |
135159-25-0 |
| بنية جزيئية |
|
| كثافة |
1.21g/cm3 |
| نقطة الغليان |
413.8°C at 760 mmHg |
| معامل الإنكسار |
1.513 |
| نقطة الوميض |
204.1°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
