ChemNet > CAS > 135306-45-5 3,5-difluoropropiophenone
135306-45-5 3,5-difluoropropiophenone
اسم المنتج |
3,5-difluoropropiophenone |
الاسم المستعار |
1-(3,5-difluorophenyl)propan-1-one; 1-(3,5-difluorophenyl)propan-2-one |
الصيغة الجزيئية |
C9H8F2O |
الوزن الجزيئي الغرامي |
170.156 |
InChI |
InChI=1/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
إستراتيجية المساعدة القطرية |
135306-45-5 |
بنية جزيئية |
|
كثافة |
1.179g/cm3 |
درجة الإنصهار |
25-27℃ |
نقطة الغليان |
191.5°C at 760 mmHg |
معامل الإنكسار |
1.472 |
نقطة الوميض |
70.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|