ChemNet > CAS > 136-64-1 Terephthalic dihydrazide
136-64-1 Terephthalic dihydrazide
| اسم المنتج |
Terephthalic dihydrazide |
| الاسم المستعار |
Benzene-1,4-dicarboxylic acid dihydrazide; benzene-1,4-dicarbohydrazide |
| الصيغة الجزيئية |
C8H10N4O2 |
| الوزن الجزيئي الغرامي |
194.1906 |
| InChI |
InChI=1/C8H10N4O2/c9-11-7(13)5-1-2-6(4-3-5)8(14)12-10/h1-4H,9-10H2,(H,11,13)(H,12,14) |
| إستراتيجية المساعدة القطرية |
136-64-1 |
| المفوضية الأوروبية رقم |
205-253-2 |
| بنية جزيئية |
|
| كثافة |
1.344g/cm3 |
| معامل الإنكسار |
1.628 |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
