ChemNet > CAS > 13735-12-1 6-Chlorothiochroman-4-one
13735-12-1 6-Chlorothiochroman-4-one
اسم المنتج |
6-Chlorothiochroman-4-one |
الاسم المستعار |
6-Chloro-3,4-dihydro-2H-1-benzothiin-4-one; 6-chloro-2,3-dihydro-4H-thiochromen-4-one |
الصيغة الجزيئية |
C9H7ClOS |
الوزن الجزيئي الغرامي |
198.6693 |
InChI |
InChI=1/C9H7ClOS/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
إستراتيجية المساعدة القطرية |
13735-12-1 |
بنية جزيئية |
|
كثافة |
1.377g/cm3 |
درجة الإنصهار |
64℃ |
نقطة الغليان |
342.7°C at 760 mmHg |
معامل الإنكسار |
1.634 |
نقطة الوميض |
161.1°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|