ChemNet > CAS > 140-38-5 4-Chlorophenylurea
140-38-5 4-Chlorophenylurea
اسم المنتج |
4-Chlorophenylurea |
الاسم المستعار |
Urea, 1-(p-chlorophenyl)-; (p-Chlorophenyl)urea; 1-(p-Chlorophenyl)urea; 4-12-00-01191 (Beilstein Handbook Reference); AI3-20197; BRN 0908492; NSC 12971; p-CPU; (4-Chlorophenyl)urea; Urea, (4-chlorophenyl)-; Urea, (p-chlorophenyl)- (8CI); 1-(4-chlorophenyl)urea |
الصيغة الجزيئية |
C7H7ClN2O |
الوزن الجزيئي الغرامي |
170.5963 |
InChI |
InChI=1/C7H7ClN2O/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
إستراتيجية المساعدة القطرية |
140-38-5 |
المفوضية الأوروبية رقم |
205-412-6 |
بنية جزيئية |
|
كثافة |
1.402g/cm3 |
نقطة الغليان |
271.7°C at 760 mmHg |
معامل الإنكسار |
1.649 |
نقطة الوميض |
118.1°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|