ChemNet > CAS > 1422-54-4 2-Bromo-6-fluorotoluene
1422-54-4 2-Bromo-6-fluorotoluene
اسم المنتج |
2-Bromo-6-fluorotoluene |
الاسم المستعار |
Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
الصيغة الجزيئية |
C7H4ClFN2S |
الوزن الجزيئي الغرامي |
202.6365 |
InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
إستراتيجية المساعدة القطرية |
1422-54-4 |
بنية جزيئية |
|
كثافة |
1.63g/cm3 |
نقطة الغليان |
294°C at 760 mmHg |
معامل الإنكسار |
1.714 |
نقطة الوميض |
131.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|