ChemNet > CAS > 1475-12-3 1-(2,5-Dichlorophenyl)ethanol
1475-12-3 1-(2,5-Dichlorophenyl)ethanol
| اسم المنتج |
1-(2,5-Dichlorophenyl)ethanol |
| الاسم المستعار |
2,5-Dichloro-alpha-methylbenzyl alcohol~2,5-Dichlorophenyl methyl carbinol; 2,5-Dichlorophenyl Ethanol |
| الصيغة الجزيئية |
C8H8Cl2O |
| الوزن الجزيئي الغرامي |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3 |
| إستراتيجية المساعدة القطرية |
1475-12-3 |
| المفوضية الأوروبية رقم |
216-018-9 |
| بنية جزيئية |
|
| كثافة |
1.323g/cm3 |
| نقطة الغليان |
257.9°C at 760 mmHg |
| معامل الإنكسار |
1.566 |
| نقطة الوميض |
112.1°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
