ChemNet > CAS > 150-83-4 3-hydroxybutyric acid, sodium salt
150-83-4 3-hydroxybutyric acid, sodium salt
اسم المنتج |
3-hydroxybutyric acid, sodium salt |
الاسم المستعار |
3-Hydroxybutyric acid sodium salt; DL-beta-Hydroxybutyric acid sodium salt; Sodium 3-hydroxybutyrate; sodium 3-hydroxybutanoate; butanoic acid, 3-hydroxy-, sodium salt (1:1); Dl-3-Hydroxybutyric Acid Sodium Salt |
الصيغة الجزيئية |
C4H8NaO3 |
الوزن الجزيئي الغرامي |
127.0943 |
InChI |
InChI=1/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7); |
إستراتيجية المساعدة القطرية |
150-83-4 |
المفوضية الأوروبية رقم |
205-774-5 |
بنية جزيئية |
|
درجة الإنصهار |
165-167℃ |
نقطة الغليان |
269.2°C at 760 mmHg |
نقطة الوميض |
121°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|