CAS No: 38411-22-2;153084-05-0, Chemical Name: 2,2',3,3',6,6'-hexachlorobiphenyl
the physical and chemical property of 38411-22-2;153084-05-0, 2,2',3,3',6,6'-hexachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 38411-22-2;153084-05-0 2,2',3,3',6,6'-hexachlorobiphenyl
38411-22-2;153084-05-0 2,2',3,3',6,6'-hexachlorobiphenyl
| اسم المنتج |
2,2',3,3',6,6'-hexachlorobiphenyl |
| الاسم المستعار |
1,1'-biphenyl, 2,2',3,3',6,6'-hexachloro-; 2,2',3,3',6,6'-Hexachlorobiphenyl; 2,2',3,3',6,6'-PCB; 38411-22-2 |
| الصيغة الجزيئية |
C12H4Cl6 |
| الوزن الجزيئي الغرامي |
360.8782 |
| InChI |
InChI=1/C12H4Cl6/c13-5-1-3-7(15)11(17)9(5)10-6(14)2-4-8(16)12(10)18/h1-4H |
| إستراتيجية المساعدة القطرية |
38411-22-2;153084-05-0 |
| بنية جزيئية |
|
| كثافة |
1.593g/cm3 |
| نقطة الغليان |
371.2°C at 760 mmHg |
| معامل الإنكسار |
1.626 |
| نقطة الوميض |
174.7°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
|
|
