ChemNet > CAS > 16296-79-0 5-chloro-1-benzothiophene-3-carbonitrile
16296-79-0 5-chloro-1-benzothiophene-3-carbonitrile
| اسم المنتج |
5-chloro-1-benzothiophene-3-carbonitrile |
| الصيغة الجزيئية |
C9H4ClNS |
| الوزن الجزيئي الغرامي |
193.6528 |
| InChI |
InChI=1/C9H4ClNS/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-3,5H |
| إستراتيجية المساعدة القطرية |
16296-79-0 |
| بنية جزيئية |
|
| كثافة |
1.42g/cm3 |
| درجة الإنصهار |
121℃ |
| نقطة الغليان |
347.9°C at 760 mmHg |
| معامل الإنكسار |
1.69 |
| نقطة الوميض |
164.2°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
