ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
اسم المنتج |
5-Nitrothiophene-2-carbonitrile |
الاسم المستعار |
2-Cyano-5-nitrothiophene |
الصيغة الجزيئية |
C5H2N2O2S |
الوزن الجزيئي الغرامي |
154.1466 |
InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
إستراتيجية المساعدة القطرية |
16689-02-4 |
بنية جزيئية |
|
كثافة |
1.5g/cm3 |
نقطة الغليان |
273.9°C at 760 mmHg |
معامل الإنكسار |
1.611 |
نقطة الوميض |
119.4°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|