ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
| اسم المنتج |
2,3-Dichlorothiophene |
| الاسم المستعار |
2,3-dichloro-thiophene |
| الصيغة الجزيئية |
C4H2Cl2S |
| الوزن الجزيئي الغرامي |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| إستراتيجية المساعدة القطرية |
17249-79-5;17249-29-5 |
| بنية جزيئية |
|
| كثافة |
1.488g/cm3 |
| درجة الإنصهار |
-26℃ |
| نقطة الغليان |
170.7°C at 760 mmHg |
| معامل الإنكسار |
1.584 |
| نقطة الوميض |
68.9°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
