ChemNet > CAS > 18662-53-8 Nitrilotriacetic acid, trisodium salt, monohydrate
18662-53-8 Nitrilotriacetic acid, trisodium salt, monohydrate
اسم المنتج |
Nitrilotriacetic acid, trisodium salt, monohydrate |
الاسم المستعار |
Nitrilotriacetic acid trisodium salt monohydrate; Nitriloacetic acid trisodium salt monohydrate; sodium 2,2',2''-nitrilotriacetate hydrate (3:1:1); NTA-3Na monohydrate |
الصيغة الجزيئية |
C6H8NNa3O7 |
الوزن الجزيئي الغرامي |
275.0995 |
InChI |
InChI=1/C6H9NO6.3Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;1H2/q;3*+1;/p-3 |
إستراتيجية المساعدة القطرية |
18662-53-8 |
المفوضية الأوروبية رقم |
205-355-7 |
بنية جزيئية |
|
درجة الإنصهار |
320℃ |
نقطة الغليان |
498.2°C at 760 mmHg |
نقطة الوميض |
255.1°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|