ChemNet > CAS > 18708-70-8 2,4,6-Trichloronitro Benzene
18708-70-8 2,4,6-Trichloronitro Benzene
| اسم المنتج |
2,4,6-Trichloronitro Benzene |
| الاسم المستعار |
2-Nitro-1,3,5-trichlorobenzene; 2,4,6-Trichloronitrobenzene; 1,3,5-trichloro-2-nitrobenzene |
| الصيغة الجزيئية |
C6H2Cl3NO2 |
| الوزن الجزيئي الغرامي |
226.4446 |
| InChI |
InChI=1/C6H2Cl3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
| إستراتيجية المساعدة القطرية |
18708-70-8 |
| المفوضية الأوروبية رقم |
242-518-1 |
| بنية جزيئية |
|
| كثافة |
1.651g/cm3 |
| درجة الإنصهار |
70-72℃ |
| نقطة الغليان |
303.2°C at 760 mmHg |
| معامل الإنكسار |
1.609 |
| نقطة الوميض |
137.2°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| شروط الأمن |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
