ChemNet > CAS > 19579-44-3 1-(2-Chlorophenyl)biguanide hydrochloride
19579-44-3 1-(2-Chlorophenyl)biguanide hydrochloride
| اسم المنتج |
1-(2-Chlorophenyl)biguanide hydrochloride |
| الاسم المستعار |
{[(2-chloroanilino)(imino)methyl]amino}methanimidamide hydrochloride; 2-(2-chlorophenyl)-1-(diaminomethylidene)guanidine; N-{(1E)-amino[(diaminomethylidene)ammonio]methylidene}-2-chloroanilinium |
| الصيغة الجزيئية |
C8H12ClN5 |
| الوزن الجزيئي الغرامي |
213.6663 |
| InChI |
InChI=1/C8H10ClN5/c9-5-3-1-2-4-6(5)13-8(12)14-7(10)11/h1-4H,(H6,10,11,12,13,14)/p+2 |
| إستراتيجية المساعدة القطرية |
19579-44-3 |
| بنية جزيئية |
|
| درجة الإنصهار |
231-234℃ |
| نقطة الغليان |
431.9°C at 760 mmHg |
| نقطة الوميض |
215°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
