ChemNet > CAS > 1958-93-6 2-fluoro-6-nitrobenzyl bromide
1958-93-6 2-fluoro-6-nitrobenzyl bromide
اسم المنتج |
2-fluoro-6-nitrobenzyl bromide |
الاسم المستعار |
2-Bromomethyl-1-fluoro-3-nitrobenzene; 2-(Bromomethyl)-1-fluoro-3-nitrobenzene |
الصيغة الجزيئية |
C7H5BrFNO2 |
الوزن الجزيئي الغرامي |
234.0225 |
InChI |
InChI=1/C7H5BrFNO2/c8-4-5-6(9)2-1-3-7(5)10(11)12/h1-3H,4H2 |
إستراتيجية المساعدة القطرية |
1958-93-6 |
المفوضية الأوروبية رقم |
217-801-8 |
بنية جزيئية |
|
كثافة |
1.733g/cm3 |
نقطة الغليان |
275.5°C at 760 mmHg |
معامل الإنكسار |
1.588 |
نقطة الوميض |
120.4°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|