ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
اسم المنتج |
Mercaptopropionicacidethylester |
الاسم المستعار |
2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
الصيغة الجزيئية |
C5H10O2S |
الوزن الجزيئي الغرامي |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
إستراتيجية المساعدة القطرية |
19788-49-9 |
المفوضية الأوروبية رقم |
243-314-5 |
بنية جزيئية |
|
كثافة |
1.04g/cm3 |
نقطة الغليان |
171.7°C at 760 mmHg |
معامل الإنكسار |
1.452 |
نقطة الوميض |
57.4°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|