ChemNet > CAS > 20029-52-1 Cyclohexybenzoicacid
20029-52-1 Cyclohexybenzoicacid
| اسم المنتج |
Cyclohexybenzoicacid |
| الاسم المستعار |
4-Cyclohexylbenzoic acid; 4-cyclohexylbenzoate |
| الصيغة الجزيئية |
C13H15O2 |
| الوزن الجزيئي الغرامي |
203.2575 |
| InChI |
InChI=1/C13H16O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10H,1-5H2,(H,14,15)/p-1 |
| إستراتيجية المساعدة القطرية |
20029-52-1 |
| المفوضية الأوروبية رقم |
243-472-5 |
| بنية جزيئية |
|
| نقطة الغليان |
351.1°C at 760 mmHg |
| نقطة الوميض |
163.9°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
