ChemNet > CAS > 202865-85-8 2-Bromo-5-iodotoluene
202865-85-8 2-Bromo-5-iodotoluene
اسم المنتج |
2-Bromo-5-iodotoluene |
الاسم المستعار |
1-bromo-4-iodo-2-methylbenzene |
الصيغة الجزيئية |
C7H6BrI |
الوزن الجزيئي الغرامي |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
202865-85-8 |
بنية جزيئية |
|
كثافة |
2.062g/cm3 |
نقطة الغليان |
264.2°C at 760 mmHg |
معامل الإنكسار |
1.636 |
نقطة الوميض |
113.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|