ChemNet > CAS > 20300-02-1 Thiophene-2-thiocarboxamide
20300-02-1 Thiophene-2-thiocarboxamide
اسم المنتج |
Thiophene-2-thiocarboxamide |
الاسم المستعار |
Thiophene-2-carbothioamide |
الصيغة الجزيئية |
C5H5NS2 |
الوزن الجزيئي الغرامي |
143.2299 |
InChI |
InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
إستراتيجية المساعدة القطرية |
20300-02-1 |
بنية جزيئية |
|
كثافة |
1.357g/cm3 |
درجة الإنصهار |
106℃ |
نقطة الغليان |
259.5°C at 760 mmHg |
معامل الإنكسار |
1.701 |
نقطة الوميض |
110.7°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R25:Toxic if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|