ChemNet > CAS > 206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate
| اسم المنتج |
2,4,6-(trifluorophenyl)isothiocyanate |
| الاسم المستعار |
2,4,6-Trifluorophenyl isothiocyanate; 1,3,5-trifluoro-2-isothiocyanatobenzene |
| الصيغة الجزيئية |
C7H2F3NS |
| الوزن الجزيئي الغرامي |
189.1577 |
| InChI |
InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| إستراتيجية المساعدة القطرية |
206761-91-3 |
| بنية جزيئية |
|
| كثافة |
1.36g/cm3 |
| نقطة الغليان |
213.9°C at 760 mmHg |
| معامل الإنكسار |
1.52 |
| نقطة الوميض |
83.1°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
