ChemNet > CAS > 2088-24-6 3-Methoxyphenoxyacetic acid
2088-24-6 3-Methoxyphenoxyacetic acid
اسم المنتج |
3-Methoxyphenoxyacetic acid |
الاسم المستعار |
Acetic acid, (3-methoxyphenoxy)-; (3-Methoxyphenoxy)acetic acid |
الصيغة الجزيئية |
C9H10O4 |
الوزن الجزيئي الغرامي |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
إستراتيجية المساعدة القطرية |
2088-24-6 |
بنية جزيئية |
|
كثافة |
1.226g/cm3 |
نقطة الغليان |
325.9°C at 760 mmHg |
معامل الإنكسار |
1.528 |
نقطة الوميض |
131.9°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|