ChemNet > CAS > 2103-91-5 2-Amino-4-(p-tolyl)thiazole
2103-91-5 2-Amino-4-(p-tolyl)thiazole
اسم المنتج |
2-Amino-4-(p-tolyl)thiazole |
الاسم المستعار |
4-(4-Methylphenyl)-2-thiazolamine; 4-(4-methylphenyl)-1,3-thiazol-2-amine |
الصيغة الجزيئية |
C10H10N2S |
الوزن الجزيئي الغرامي |
190.2648 |
InChI |
InChI=1/C10H10N2S/c1-7-2-4-8(5-3-7)9-6-13-10(11)12-9/h2-6H,1H3,(H2,11,12) |
إستراتيجية المساعدة القطرية |
2103-91-5 |
بنية جزيئية |
|
كثافة |
1.219g/cm3 |
درجة الإنصهار |
132-136℃ |
نقطة الغليان |
369.4°C at 760 mmHg |
معامل الإنكسار |
1.642 |
نقطة الوميض |
177.2°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|