ChemNet > CAS > 212779-19-6 2,3,5-Trichlorobenzeneboronic acid
212779-19-6 2,3,5-Trichlorobenzeneboronic acid
اسم المنتج |
2,3,5-Trichlorobenzeneboronic acid |
الاسم المستعار |
Thiocarbamoylhydrazine; (2,3,5-trichlorophenyl)boronic acid; Boronic acid,B-(2,3,5-trichlorophenyl)-; 2,3,5-Trichlorophenylboronic acid |
الصيغة الجزيئية |
C6H4BCl3O2 |
الوزن الجزيئي الغرامي |
225.2648 |
InChI |
InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
إستراتيجية المساعدة القطرية |
212779-19-6 |
بنية جزيئية |
|
كثافة |
1.6g/cm3 |
نقطة الغليان |
383.4°C at 760 mmHg |
معامل الإنكسار |
1.594 |
نقطة الوميض |
185.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|