ChemNet > CAS > 21298-53-3 3-(2-Thienyl)pyridine
21298-53-3 3-(2-Thienyl)pyridine
اسم المنتج |
3-(2-Thienyl)pyridine |
الاسم المستعار |
2-(3-Pyridyl)thiophene; 3-(thiophen-2-yl)pyridine |
الصيغة الجزيئية |
C9H7NS |
الوزن الجزيئي الغرامي |
161.2236 |
InChI |
InChI=1/C9H7NS/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1-7H |
إستراتيجية المساعدة القطرية |
21298-53-3 |
بنية جزيئية |
|
كثافة |
1.173g/cm3 |
نقطة الغليان |
278.6°C at 760 mmHg |
معامل الإنكسار |
1.604 |
نقطة الوميض |
121.8°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|