ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
| اسم المنتج |
3-(trifluoromethyl)phenoxyacetonitrile |
| الاسم المستعار |
2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
| الصيغة الجزيئية |
C8H7FO3 |
| الوزن الجزيئي الغرامي |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
| إستراتيجية المساعدة القطرية |
2145-31-5 |
| بنية جزيئية |
|
| كثافة |
1.309g/cm3 |
| نقطة الغليان |
268.9°C at 760 mmHg |
| معامل الإنكسار |
1.526 |
| نقطة الوميض |
116.4°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|
