ChemNet > CAS > 215-58-7 1,2,3,4-Dibenzanthracene
215-58-7 1,2,3,4-Dibenzanthracene
اسم المنتج |
1,2,3,4-Dibenzanthracene |
الاسم المستعار |
Dibenz[a,c]anthracene; dibenz(a,c)anthracene; 1,2:3,4-dibenzanthracene; Benztriphenylene; 2,3-Benztriphenylene; benzo[f]tetraphene |
الصيغة الجزيئية |
C22H14 |
الوزن الجزيئي الغرامي |
278.3466 |
InChI |
InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
إستراتيجية المساعدة القطرية |
215-58-7 |
المفوضية الأوروبية رقم |
205-920-8 |
بنية جزيئية |
|
كثافة |
1.232g/cm3 |
درجة الإنصهار |
202-207℃ |
نقطة الغليان |
518°C at 760 mmHg |
معامل الإنكسار |
1.811 |
نقطة الوميض |
264.5°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R40:Possible risks of irreversible effects.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|