ChemNet > CAS > 21545-54-0 1-Cyclohexyl-3-(2-morpholinoethyl)thiourea
21545-54-0 1-Cyclohexyl-3-(2-morpholinoethyl)thiourea
اسم المنتج |
1-Cyclohexyl-3-(2-morpholinoethyl)thiourea |
الاسم المستعار |
Thiourea, N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)-; 1-Cyclohexyl-3-(2-morpholinoethyl)-2-thiourea; 4-27-00-00391 (Beilstein Handbook Reference); BRN 0018505; N-Cyclohexyl-N'-(2-(4-morpholinyl)ethyl)thiourea; U 18305; Urea, 1-cyclohexyl-3-(2-morpholinoethyl)-2-thio-; 1-cyclohexyl-3-[2-(morpholin-4-yl)ethyl]thiourea |
الصيغة الجزيئية |
C13H25N3OS |
الوزن الجزيئي الغرامي |
271.4221 |
InChI |
InChI=1/C13H25N3OS/c18-13(15-12-4-2-1-3-5-12)14-6-7-16-8-10-17-11-9-16/h12H,1-11H2,(H2,14,15,18) |
إستراتيجية المساعدة القطرية |
21545-54-0 |
المفوضية الأوروبية رقم |
244-436-1 |
بنية جزيئية |
|
كثافة |
1.13g/cm3 |
درجة الإنصهار |
125-126℃ |
نقطة الغليان |
394.1°C at 760 mmHg |
معامل الإنكسار |
1.566 |
نقطة الوميض |
192.1°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|