ChemNet > CAS > 2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
| اسم المنتج |
4-Chloro-alpha-methylphenylacetonitrile |
| الاسم المستعار |
2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
| الصيغة الجزيئية |
C9H8ClN |
| الوزن الجزيئي الغرامي |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
| إستراتيجية المساعدة القطرية |
2184-88-5 |
| المفوضية الأوروبية رقم |
218-569-0 |
| بنية جزيئية |
|
| كثافة |
1.143g/cm3 |
| نقطة الغليان |
260.3°C at 760 mmHg |
| معامل الإنكسار |
1.537 |
| نقطة الوميض |
104°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|
