ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
| اسم المنتج |
3,4,5-trifluoroacetophenone |
| الاسم المستعار |
3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
| الصيغة الجزيئية |
C8H5F3O |
| الوزن الجزيئي الغرامي |
174.1199 |
| InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
| إستراتيجية المساعدة القطرية |
220141-73-1 |
| بنية جزيئية |
|
| كثافة |
1.303g/cm3 |
| نقطة الغليان |
208.8°C at 760 mmHg |
| معامل الإنكسار |
1.455 |
| نقطة الوميض |
72.5°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
