ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
| اسم المنتج |
Bis-(4-chlorophenylthio)methane |
| الاسم المستعار |
Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
| الصيغة الجزيئية |
C13H10Cl2S2 |
| الوزن الجزيئي الغرامي |
301.2545 |
| InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
| إستراتيجية المساعدة القطرية |
2393-97-7 |
| بنية جزيئية |
|
| كثافة |
1.38g/cm3 |
| درجة الإنصهار |
45-48℃ |
| نقطة الغليان |
420.9°C at 760 mmHg |
| معامل الإنكسار |
1.677 |
| نقطة الوميض |
192.5°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
