ChemNet > CAS > 2444-19-1 4-Hydroxyphenyl benzoate
2444-19-1 4-Hydroxyphenyl benzoate
| اسم المنتج |
4-Hydroxyphenyl benzoate |
| الاسم المستعار |
Benzoic acid 4-hydroxyphenyl ester; Hydroquinone monobenzoate; Benzoicacid 4-hydroxyphenylester |
| الصيغة الجزيئية |
C13H10O3 |
| الوزن الجزيئي الغرامي |
214.2167 |
| InChI |
InChI=1/C13H10O3/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9,14H |
| إستراتيجية المساعدة القطرية |
2444-19-1 |
| المفوضية الأوروبية رقم |
219-479-4 |
| بنية جزيئية |
|
| كثافة |
1.25g/cm3 |
| نقطة الغليان |
376.6°C at 760 mmHg |
| معامل الإنكسار |
1.615 |
| نقطة الوميض |
164.7°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
