ChemNet > CAS > 25084-14-4 5-Nitro-2-furoylchloride
25084-14-4 5-Nitro-2-furoylchloride
اسم المنتج |
5-Nitro-2-furoylchloride |
الاسم المستعار |
5-Nitro-2-furoyl chloride; 5-Nitrofuran-2-carbonyl chloride |
الصيغة الجزيئية |
C5H2ClNO4 |
الوزن الجزيئي الغرامي |
175.5267 |
InChI |
InChI=1/C5H2ClNO4/c6-5(8)3-1-2-4(11-3)7(9)10/h1-2H |
إستراتيجية المساعدة القطرية |
25084-14-4 |
المفوضية الأوروبية رقم |
246-607-6 |
بنية جزيئية |
|
كثافة |
1.588g/cm3 |
نقطة الغليان |
272.7°C at 760 mmHg |
معامل الإنكسار |
1.552 |
نقطة الوميض |
118.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|