ChemNet > CAS > 261762-35-0 5-Bromo-2,3-difluoroanisole
261762-35-0 5-Bromo-2,3-difluoroanisole
| اسم المنتج |
5-Bromo-2,3-difluoroanisole |
| الاسم المستعار |
2.3-Difluoro-5-Bromoanisole; 5-bromo-1,2-difluoro-3-methoxybenzene |
| الصيغة الجزيئية |
C7H5BrF2O |
| الوزن الجزيئي الغرامي |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,1H3 |
| إستراتيجية المساعدة القطرية |
261762-35-0 |
| بنية جزيئية |
|
| كثافة |
1.615g/cm3 |
| نقطة الغليان |
193.7°C at 760 mmHg |
| معامل الإنكسار |
1.5 |
| نقطة الوميض |
84.6°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
