ChemNet > CAS > 261762-35-0 5-Bromo-2,3-difluoroanisole
261762-35-0 5-Bromo-2,3-difluoroanisole
اسم المنتج |
5-Bromo-2,3-difluoroanisole |
الاسم المستعار |
2.3-Difluoro-5-Bromoanisole; 5-bromo-1,2-difluoro-3-methoxybenzene |
الصيغة الجزيئية |
C7H5BrF2O |
الوزن الجزيئي الغرامي |
223.0148 |
InChI |
InChI=1/C7H5BrF2O/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,1H3 |
إستراتيجية المساعدة القطرية |
261762-35-0 |
بنية جزيئية |
|
كثافة |
1.615g/cm3 |
نقطة الغليان |
193.7°C at 760 mmHg |
معامل الإنكسار |
1.5 |
نقطة الوميض |
84.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|